NSC 29484
1-(1,3-benzodioxol-5-yl)propan-1-one
CAS: 28281-49-4
Molecular Formula: C10H10O3
NSC 29484 - Names and Identifiers
| Name | 1-(1,3-benzodioxol-5-yl)propan-1-one |
| Synonyms | NSC 29484 AI3-31258 ai3-31258 5-PROPIONYL-1,3-BENZODIOXOLE 3,4-(METHYLENEDIOXY)PROPIOPHENONE 3,4-(Methylenedioxy)Propiophenone 1-(1,3-benzodioxol-5-yl)-1-propanon 3',4'-(METHYLENEDIOXY)PROPIOPHENONE 1-(1,3-Benzodioxol-5-yl)-1-propanone 1-(1,3-benzodioxol-5-yl)propan-1-one 1-(1,3-Benzodioxol-5-yl)propan-1-one 1-Propanone, 1-(1,3-benzodioxol-5-yl)- 1-(3,4-METHYLENEDIOXYPHENYL)-1-PROPANONE Propiophenone, 3',4'-(methylenedioxy)- (8CI) |
| CAS | 28281-49-4 |
| EINECS | 248-937-6 |
| InChI | InChI=1/C10H10O3/c1-2-8(11)7-3-4-9-10(5-7)13-6-12-9/h3-5H,2,6H2,1H3 |
NSC 29484 - Physico-chemical Properties
| Molecular Formula | C10H10O3 |
| Molar Mass | 178.18 |
| Density | 1,21 g/cm3 |
| Melting Point | 34-36°C |
| Boling Point | 165-168°C 20mm |
| Flash Point | 165-168°C/20mm |
| Vapor Presure | 0.000771mmHg at 25°C |
| BRN | 165729 |
| Refractive Index | 1.546 |
NSC 29484 - Risk and Safety
| Hazard Symbols | Xn - Harmful |
| Risk Codes | R33 - Danger of cumulative effects R22 - Harmful if swallowed |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S37 - Wear suitable gloves. |
| RTECS | UC0440600 |
